C10H18S — CID 6435868
(2Z)-3,7-dimethylocta-2,6-diene-1-thiol (PubChem CID 6435868) has the molecular formula C10H18S and a molecular weight of 170.32 g/mol. Its IUPAC name is (2Z)-3,7-dimethylocta-2,6-diene-1-thiol.
| Compound Name | (2Z)-3,7-dimethylocta-2,6-diene-1-thiol |
|---|---|
| PubChem CID | 6435868 |
| Molecular Formula | C10H18S |
| Molecular Weight | 170.32 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | (2Z)-3,7-dimethylocta-2,6-diene-1-thiol |
| SMILES | CC(C)=CCC/C(C)=C\CS |
| InChI | InChI=1S/C10H18S/c1-9(2)5-4-6-10(3)7-8-11/h5,7,11H,4,6,8H2,1-3H3/b10-7- |
| InChIKey | FACAUSJJVBMWLV-YFHOEESVSA-N |
| XLogP | 3.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.32 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|