C25H32O2 — CID 6439660
2-[(2Z,4Z,6Z,8Z)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenylidene]cyclopentane-1,3-dione (PubChem CID 6439660) has the molecular formula C25H32O2 and a molecular weight of 364.53 g/mol. Its IUPAC name is 2-[(2Z,4Z,6Z,8Z)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenylidene]cyclopentane-1,3-dione.
| Compound Name | 2-[(2Z,4Z,6Z,8Z)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenylidene]cyclopentane-1,3-dione |
|---|---|
| PubChem CID | 6439660 |
| Molecular Formula | C25H32O2 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | 2-[(2Z,4Z,6Z,8Z)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenylidene]cyclopentane-1,3-dione |
| SMILES | CC1=C(/C=C\C(C)=C/C=C\C(C)=C/C=C2C(=O)CCC2=O)C(C)(C)CCC1 |
| InChI | InChI=1S/C25H32O2/c1-18(11-13-21-23(26)15-16-24(21)27)8-6-9-19(2)12-14-22-20(3)10-7-17-25(22,4)5/h6,8-9,11-14H,7,10,15-17H2,1-5H3/b8-6-,14-12-,18-11-,19-9- |
| InChIKey | LVCYXBNPMHAQIJ-WXLUHSLYSA-N |
| XLogP | 6.38 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|