C17H30O3 — CID 6440588
(2Z,6E)-5-(oxan-2-yloxy)dodeca-2,6-dien-1-ol (PubChem CID 6440588) has the molecular formula C17H30O3 and a molecular weight of 282.42 g/mol. Its IUPAC name is (2Z,6E)-5-(oxan-2-yloxy)dodeca-2,6-dien-1-ol.
| Compound Name | (2Z,6E)-5-(oxan-2-yloxy)dodeca-2,6-dien-1-ol |
|---|---|
| PubChem CID | 6440588 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | (2Z,6E)-5-(oxan-2-yloxy)dodeca-2,6-dien-1-ol |
| SMILES | CCCCC/C=C/C(C/C=C\CO)OC1CCCCO1 |
| InChI | InChI=1S/C17H30O3/c1-2-3-4-5-6-11-16(12-7-9-14-18)20-17-13-8-10-15-19-17/h6-7,9,11,16-18H,2-5,8,10,12-15H2,1H3/b9-7-,11-6+ |
| InChIKey | RTSVXZIATMTWDK-IBDCXDMFSA-N |
| XLogP | 3.97 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|