(E)-6-methylhept-4-enoyl chloride

C8H13ClO — CID 6442814

IUPAC(E)-6-methylhept-4-enoyl chloride
SMILESCC(C)/C=C/CCC(=O)Cl
InChIInChI=1S/C8H13ClO/c1-7(2)5-3-4-6-8(9)10/h3,5,7H,4,6H2,1-2H3/b5-3+
InChIKeyYKGNGFDRMICMPK-HWKANZROSA-N
MW160.64 g/mol
LogP2.74
Rot. Bonds4

About (E)-6-methylhept-4-enoyl chloride

(E)-6-methylhept-4-enoyl chloride (PubChem CID 6442814) has the molecular formula C8H13ClO and a molecular weight of 160.64 g/mol. Its IUPAC name is (E)-6-methylhept-4-enoyl chloride.

Molecular Properties

Compound Name(E)-6-methylhept-4-enoyl chloride
PubChem CID6442814
Molecular FormulaC8H13ClO
Molecular Weight160.64 g/mol
Exact Mass160.07
IUPAC Name(E)-6-methylhept-4-enoyl chloride
SMILESCC(C)/C=C/CCC(=O)Cl
InChIInChI=1S/C8H13ClO/c1-7(2)5-3-4-6-8(9)10/h3,5,7H,4,6H2,1-2H3/b5-3+
InChIKeyYKGNGFDRMICMPK-HWKANZROSA-N
XLogP2.74
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500160.64
LogP ≤ 52.74
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (E)-6-methylhept-4-enoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

8-Methyl-6-nonenoyl chloride
CID 6442332
1-Methyl-2,5-cyclohexadiene-1-carbonyl chloride
CID 11332598
2-Methyl-4-pentenoyl chloride
CID 12921442
4-Decenoyl chloride
CID 15920950
(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl chloride
CID 46928339
Crotyl acetylchloride
CID 54191606
(5Z,8Z,11Z,14Z,17Z)-5,8,11,14,17-eicosapentaenoylchloride
CID 58160533
(E)-oct-4-enedioyl dichloride
CID 59029064
(z)-5-Decenoyl chloride
CID 129776010
8-Methyl-4-nonenoyl chloride
CID 129822619
(Z)-2-methyloct-6-enoyl chloride
CID 134893123
(3S)-3-methylpent-4-enoyl chloride
CID 134964174

Frequently Asked Questions

What is the IUPAC name of (E)-6-methylhept-4-enoyl chloride?
The IUPAC name of (E)-6-methylhept-4-enoyl chloride (CID 6442814) is (E)-6-methylhept-4-enoyl chloride.
What is the SMILES notation for (E)-6-methylhept-4-enoyl chloride?
The canonical SMILES for (E)-6-methylhept-4-enoyl chloride is CC(C)/C=C/CCC(=O)Cl.
What is the InChIKey of (E)-6-methylhept-4-enoyl chloride?
The InChIKey is YKGNGFDRMICMPK-HWKANZROSA-N. The full InChI is InChI=1S/C8H13ClO/c1-7(2)5-3-4-6-8(9)10/h3,5,7H,4,6H2,1-2H3/b5-3+.
What are the key properties of (E)-6-methylhept-4-enoyl chloride?
(E)-6-methylhept-4-enoyl chloride has a molecular weight of 160.64 g/mol, XLogP of 2.74, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-6-methylhept-4-enoyl chloride is sourced from PubChem (CID 6442814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).