C17H26O9 — CID 6443449
(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[(E)-3-(3-methoxycarbonyl-2,2-dimethylcyclopropyl)-2-methylprop-2-enoxy]oxane-2-carboxylic acid (PubChem CID 6443449) has the molecular formula C17H26O9 and a molecular weight of 374.39 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[(E)-3-(3-methoxycarbonyl-2,2-dimethylcyclopropyl)-2-methylprop-2-enoxy]oxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[(E)-3-(3-methoxycarbonyl-2,2-dimethylcyclopropyl)-2-methylprop-2-enoxy]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 6443449 |
| Molecular Formula | C17H26O9 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[(E)-3-(3-methoxycarbonyl-2,2-dimethylcyclopropyl)-2-methylprop-2-enoxy]oxane-2-carboxylic acid |
| SMILES | COC(=O)C1C(/C=C(\C)CO[C@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)C1(C)C |
| InChI | InChI=1S/C17H26O9/c1-7(5-8-9(15(23)24-4)17(8,2)3)6-25-16-12(20)10(18)11(19)13(26-16)14(21)22/h5,8-13,16,18-20H,6H2,1-4H3,(H,21,22)/b7-5+/t8?,9?,10-,11-,12+,13-,16-/m0/s1 |
| InChIKey | YSYLNMQGGFVEGE-CIGOPOFMSA-N |
| XLogP | -0.71 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|