C28H32N2O10 — CID 6448102
1-[2-(6H-benzo[b][1,4]benzodioxepin-6-yl)ethyl]-4-methylpiperazine;bis((E)-but-2-enedioic acid) (PubChem CID 6448102) has the molecular formula C28H32N2O10 and a molecular weight of 556.57 g/mol. Its IUPAC name is 1-[2-(6H-benzo[b][1,4]benzodioxepin-6-yl)ethyl]-4-methylpiperazine;bis((E)-but-2-enedioic acid).
| Compound Name | 1-[2-(6H-benzo[b][1,4]benzodioxepin-6-yl)ethyl]-4-methylpiperazine;bis((E)-but-2-enedioic acid) |
|---|---|
| PubChem CID | 6448102 |
| Molecular Formula | C28H32N2O10 |
| Molecular Weight | 556.57 g/mol |
| Exact Mass | 556.21 |
| IUPAC Name | 1-[2-(6H-benzo[b][1,4]benzodioxepin-6-yl)ethyl]-4-methylpiperazine;bis((E)-but-2-enedioic acid) |
| SMILES | CN1CCN(CCC2Oc3ccccc3Oc3ccccc32)CC1.O=C(O)/C=C/C(=O)O.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C20H24N2O2.2C4H4O4/c1-21-12-14-22(15-13-21)11-10-18-16-6-2-3-7-17(16)23-19-8-4-5-9-20(19)24-18;2*5-3(6)1-2-4(7)8/h2-9,18H,10-15H2,1H3;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1+ |
| InChIKey | FXDMSNMLFJHPPJ-LVEZLNDCSA-N |
| XLogP | 2.97 |
| TPSA | 174.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.57 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|