C23H37NO6S — CID 6449159
(E)-but-2-enedioic acid;2-(4-heptylsulfanyl-2,5-dimethoxyphenyl)-N,N-dimethylethanamine (PubChem CID 6449159) has the molecular formula C23H37NO6S and a molecular weight of 455.62 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;2-(4-heptylsulfanyl-2,5-dimethoxyphenyl)-N,N-dimethylethanamine.
| Compound Name | (E)-but-2-enedioic acid;2-(4-heptylsulfanyl-2,5-dimethoxyphenyl)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 6449159 |
| Molecular Formula | C23H37NO6S |
| Molecular Weight | 455.62 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | (E)-but-2-enedioic acid;2-(4-heptylsulfanyl-2,5-dimethoxyphenyl)-N,N-dimethylethanamine |
| SMILES | CCCCCCCSc1cc(OC)c(CCN(C)C)cc1OC.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C19H33NO2S.C4H4O4/c1-6-7-8-9-10-13-23-19-15-17(21-4)16(11-12-20(2)3)14-18(19)22-5;5-3(6)1-2-4(7)8/h14-15H,6-13H2,1-5H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | IZCDQAZLFGWYIB-WLHGVMLRSA-N |
| XLogP | 4.58 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.62 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|