C14H14ClNOS — CID 64506573
4-(chloromethyl)-2-(2,2-dimethyl-3H-1-benzofuran-7-yl)-1,3-thiazole (PubChem CID 64506573) has the molecular formula C14H14ClNOS and a molecular weight of 279.79 g/mol. Its IUPAC name is 4-(chloromethyl)-2-(2,2-dimethyl-3H-1-benzofuran-7-yl)-1,3-thiazole.
| Compound Name | 4-(chloromethyl)-2-(2,2-dimethyl-3H-1-benzofuran-7-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 64506573 |
| Molecular Formula | C14H14ClNOS |
| Molecular Weight | 279.79 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 4-(chloromethyl)-2-(2,2-dimethyl-3H-1-benzofuran-7-yl)-1,3-thiazole |
| SMILES | CC1(C)Cc2cccc(-c3nc(CCl)cs3)c2O1 |
| InChI | InChI=1S/C14H14ClNOS/c1-14(2)6-9-4-3-5-11(12(9)17-14)13-16-10(7-15)8-18-13/h3-5,8H,6-7H2,1-2H3 |
| InChIKey | ZFYMFVLPGHFXQH-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.79 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|