C14H14BrN3O — CID 66296826
5-bromo-2-(2,2-dimethyl-3H-1-benzofuran-7-yl)pyrimidin-4-amine (PubChem CID 66296826) has the molecular formula C14H14BrN3O and a molecular weight of 320.19 g/mol. Its IUPAC name is 5-bromo-2-(2,2-dimethyl-3H-1-benzofuran-7-yl)pyrimidin-4-amine.
| Compound Name | 5-bromo-2-(2,2-dimethyl-3H-1-benzofuran-7-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 66296826 |
| Molecular Formula | C14H14BrN3O |
| Molecular Weight | 320.19 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | 5-bromo-2-(2,2-dimethyl-3H-1-benzofuran-7-yl)pyrimidin-4-amine |
| SMILES | CC1(C)Cc2cccc(-c3ncc(Br)c(N)n3)c2O1 |
| InChI | InChI=1S/C14H14BrN3O/c1-14(2)6-8-4-3-5-9(11(8)19-14)13-17-7-10(15)12(16)18-13/h3-5,7H,6H2,1-2H3,(H2,16,17,18) |
| InChIKey | PDZBYNWONDEOGV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.19 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |