C13H16N4O — CID 64507030
4-(2,2-dimethyl-3H-1-benzofuran-7-yl)imidazole-1,5-diamine (PubChem CID 64507030) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is 4-(2,2-dimethyl-3H-1-benzofuran-7-yl)imidazole-1,5-diamine.
| Compound Name | 4-(2,2-dimethyl-3H-1-benzofuran-7-yl)imidazole-1,5-diamine |
|---|---|
| PubChem CID | 64507030 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 4-(2,2-dimethyl-3H-1-benzofuran-7-yl)imidazole-1,5-diamine |
| SMILES | CC1(C)Cc2cccc(-c3ncn(N)c3N)c2O1 |
| InChI | InChI=1S/C13H16N4O/c1-13(2)6-8-4-3-5-9(11(8)18-13)10-12(14)17(15)7-16-10/h3-5,7H,6,14-15H2,1-2H3 |
| InChIKey | OAAKQWAUIUISGS-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |