C14H13BrN2O2 — CID 66313164
5-bromo-2-(2,2-dimethyl-3H-1-benzofuran-7-yl)-1H-pyrimidin-6-one (PubChem CID 66313164) has the molecular formula C14H13BrN2O2 and a molecular weight of 321.17 g/mol. Its IUPAC name is 5-bromo-2-(2,2-dimethyl-3H-1-benzofuran-7-yl)-1H-pyrimidin-6-one.
| Compound Name | 5-bromo-2-(2,2-dimethyl-3H-1-benzofuran-7-yl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 66313164 |
| Molecular Formula | C14H13BrN2O2 |
| Molecular Weight | 321.17 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 5-bromo-2-(2,2-dimethyl-3H-1-benzofuran-7-yl)-1H-pyrimidin-6-one |
| SMILES | CC1(C)Cc2cccc(-c3ncc(Br)c(=O)[nH]3)c2O1 |
| InChI | InChI=1S/C14H13BrN2O2/c1-14(2)6-8-4-3-5-9(11(8)19-14)12-16-7-10(15)13(18)17-12/h3-5,7H,6H2,1-2H3,(H,16,17,18) |
| InChIKey | KIOWUDOMEQBHOM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.17 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |