C18H20INO — CID 64508368
N-[(2,2-dimethyl-3H-1-benzofuran-7-yl)methyl]-3-iodo-4-methylaniline (PubChem CID 64508368) has the molecular formula C18H20INO and a molecular weight of 393.27 g/mol. Its IUPAC name is N-[(2,2-dimethyl-3H-1-benzofuran-7-yl)methyl]-3-iodo-4-methylaniline.
| Compound Name | N-[(2,2-dimethyl-3H-1-benzofuran-7-yl)methyl]-3-iodo-4-methylaniline |
|---|---|
| PubChem CID | 64508368 |
| Molecular Formula | C18H20INO |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | N-[(2,2-dimethyl-3H-1-benzofuran-7-yl)methyl]-3-iodo-4-methylaniline |
| SMILES | Cc1ccc(NCc2cccc3c2OC(C)(C)C3)cc1I |
| InChI | InChI=1S/C18H20INO/c1-12-7-8-15(9-16(12)19)20-11-14-6-4-5-13-10-18(2,3)21-17(13)14/h4-9,20H,10-11H2,1-3H3 |
| InChIKey | FQXDZKMZYYOTGK-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|