About 4-chloro-2-(2,2-dimethyl-3H-1-benzofuran-7-yl)-6-propylpyrimidine
4-chloro-2-(2,2-dimethyl-3H-1-benzofuran-7-yl)-6-propylpyrimidine (PubChem CID 64509260) has the molecular formula C17H19ClN2O
and a molecular weight of 302.81 g/mol. Its IUPAC name is 4-chloro-2-(2,2-dimethyl-3H-1-benzofuran-7-yl)-6-propylpyrimidine.
Molecular Properties
| Compound Name | 4-chloro-2-(2,2-dimethyl-3H-1-benzofuran-7-yl)-6-propylpyrimidine |
| PubChem CID | 64509260 |
| Molecular Formula | C17H19ClN2O |
| Molecular Weight | 302.81 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 4-chloro-2-(2,2-dimethyl-3H-1-benzofuran-7-yl)-6-propylpyrimidine |
| SMILES | CCCc1cc(Cl)nc(-c2cccc3c2OC(C)(C)C3)n1 |
| InChI | InChI=1S/C17H19ClN2O/c1-4-6-12-9-14(18)20-16(19-12)13-8-5-7-11-10-17(2,3)21-15(11)13/h5,7-9H,4,6,10H2,1-3H3 |
| InChIKey | BNMHGSNEUOSROV-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.81 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-2-(2,2-dimethyl-3H-1-benzofuran-7-yl)-6-propylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-(2,2-dimethyl-3H-1-benzofuran-7-yl)-6-propylpyrimidine?
The IUPAC name of 4-chloro-2-(2,2-dimethyl-3H-1-benzofuran-7-yl)-6-propylpyrimidine (CID 64509260) is 4-chloro-2-(2,2-dimethyl-3H-1-benzofuran-7-yl)-6-propylpyrimidine.
What is the SMILES notation for 4-chloro-2-(2,2-dimethyl-3H-1-benzofuran-7-yl)-6-propylpyrimidine?
The canonical SMILES for 4-chloro-2-(2,2-dimethyl-3H-1-benzofuran-7-yl)-6-propylpyrimidine is CCCc1cc(Cl)nc(-c2cccc3c2OC(C)(C)C3)n1.
What is the InChIKey of 4-chloro-2-(2,2-dimethyl-3H-1-benzofuran-7-yl)-6-propylpyrimidine?
The InChIKey is BNMHGSNEUOSROV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19ClN2O/c1-4-6-12-9-14(18)20-16(19-12)13-8-5-7-11-10-17(2,3)21-15(11)13/h5,7-9H,4,6,10H2,1-3H3.
What are the key properties of 4-chloro-2-(2,2-dimethyl-3H-1-benzofuran-7-yl)-6-propylpyrimidine?
4-chloro-2-(2,2-dimethyl-3H-1-benzofuran-7-yl)-6-propylpyrimidine has a molecular weight of 302.81 g/mol, XLogP of 4.46, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-(2,2-dimethyl-3H-1-benzofuran-7-yl)-6-propylpyrimidine is sourced from PubChem (CID 64509260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).