About ethyl 3-(azepan-1-yl)hexanoate
ethyl 3-(azepan-1-yl)hexanoate (PubChem CID 64528200) has the molecular formula C14H27NO2
and a molecular weight of 241.37 g/mol. Its IUPAC name is ethyl 3-(azepan-1-yl)hexanoate.
Molecular Properties
| Compound Name | ethyl 3-(azepan-1-yl)hexanoate |
| PubChem CID | 64528200 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | ethyl 3-(azepan-1-yl)hexanoate |
| SMILES | CCCC(CC(=O)OCC)N1CCCCCC1 |
| InChI | InChI=1S/C14H27NO2/c1-3-9-13(12-14(16)17-4-2)15-10-7-5-6-8-11-15/h13H,3-12H2,1-2H3 |
| InChIKey | VVGSRLVLUZMMNN-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 3-(azepan-1-yl)hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(azepan-1-yl)hexanoate?
The IUPAC name of ethyl 3-(azepan-1-yl)hexanoate (CID 64528200) is ethyl 3-(azepan-1-yl)hexanoate.
What is the SMILES notation for ethyl 3-(azepan-1-yl)hexanoate?
The canonical SMILES for ethyl 3-(azepan-1-yl)hexanoate is CCCC(CC(=O)OCC)N1CCCCCC1.
What is the InChIKey of ethyl 3-(azepan-1-yl)hexanoate?
The InChIKey is VVGSRLVLUZMMNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NO2/c1-3-9-13(12-14(16)17-4-2)15-10-7-5-6-8-11-15/h13H,3-12H2,1-2H3.
What are the key properties of ethyl 3-(azepan-1-yl)hexanoate?
ethyl 3-(azepan-1-yl)hexanoate has a molecular weight of 241.37 g/mol, XLogP of 2.98, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(azepan-1-yl)hexanoate is sourced from PubChem (CID 64528200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).