About N-(1H-imidazol-2-ylmethyl)-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine
N-(1H-imidazol-2-ylmethyl)-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine (PubChem CID 64530030) has the molecular formula C12H13N3O2S
and a molecular weight of 263.32 g/mol. Its IUPAC name is N-(1H-imidazol-2-ylmethyl)-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine.
Molecular Properties
| Compound Name | N-(1H-imidazol-2-ylmethyl)-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine |
| PubChem CID | 64530030 |
| Molecular Formula | C12H13N3O2S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | N-(1H-imidazol-2-ylmethyl)-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine |
| SMILES | O=S1(=O)CC(NCc2ncc[nH]2)c2ccccc21 |
| InChI | InChI=1S/C12H13N3O2S/c16-18(17)8-10(9-3-1-2-4-11(9)18)15-7-12-13-5-6-14-12/h1-6,10,15H,7-8H2,(H,13,14) |
| InChIKey | RWIKNWCLVBYHOJ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(1H-imidazol-2-ylmethyl)-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1H-imidazol-2-ylmethyl)-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine?
The IUPAC name of N-(1H-imidazol-2-ylmethyl)-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine (CID 64530030) is N-(1H-imidazol-2-ylmethyl)-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine.
What is the SMILES notation for N-(1H-imidazol-2-ylmethyl)-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine?
The canonical SMILES for N-(1H-imidazol-2-ylmethyl)-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine is O=S1(=O)CC(NCc2ncc[nH]2)c2ccccc21.
What is the InChIKey of N-(1H-imidazol-2-ylmethyl)-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine?
The InChIKey is RWIKNWCLVBYHOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3O2S/c16-18(17)8-10(9-3-1-2-4-11(9)18)15-7-12-13-5-6-14-12/h1-6,10,15H,7-8H2,(H,13,14).
What are the key properties of N-(1H-imidazol-2-ylmethyl)-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine?
N-(1H-imidazol-2-ylmethyl)-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine has a molecular weight of 263.32 g/mol, XLogP of 1.03, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1H-imidazol-2-ylmethyl)-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine is sourced from PubChem (CID 64530030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).