C20H22NO4P — CID 6453455
(1,1-diphenyl-4-pyrrolidin-1-ylbut-2-ynyl) dihydrogen phosphate (PubChem CID 6453455) has the molecular formula C20H22NO4P and a molecular weight of 371.37 g/mol. Its IUPAC name is (1,1-diphenyl-4-pyrrolidin-1-ylbut-2-ynyl) dihydrogen phosphate.
| Compound Name | (1,1-diphenyl-4-pyrrolidin-1-ylbut-2-ynyl) dihydrogen phosphate |
|---|---|
| PubChem CID | 6453455 |
| Molecular Formula | C20H22NO4P |
| Molecular Weight | 371.37 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | (1,1-diphenyl-4-pyrrolidin-1-ylbut-2-ynyl) dihydrogen phosphate |
| SMILES | O=P(O)(O)OC(C#CCN1CCCC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H22NO4P/c22-26(23,24)25-20(18-10-3-1-4-11-18,19-12-5-2-6-13-19)14-9-17-21-15-7-8-16-21/h1-6,10-13H,7-8,15-17H2,(H2,22,23,24) |
| InChIKey | JYHYNWDPSMBHNH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.37 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|