About oxalic acid;2-(4-pyrrolidin-1-ylbut-2-ynoxy)isoindole-1,3-dione
oxalic acid;2-(4-pyrrolidin-1-ylbut-2-ynoxy)isoindole-1,3-dione (PubChem CID 21153520) has the molecular formula C18H18N2O7
and a molecular weight of 374.35 g/mol. Its IUPAC name is oxalic acid;2-(4-pyrrolidin-1-ylbut-2-ynoxy)isoindole-1,3-dione.
Molecular Properties
| Compound Name | oxalic acid;2-(4-pyrrolidin-1-ylbut-2-ynoxy)isoindole-1,3-dione |
| PubChem CID | 21153520 |
| Molecular Formula | C18H18N2O7 |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | oxalic acid;2-(4-pyrrolidin-1-ylbut-2-ynoxy)isoindole-1,3-dione |
| SMILES | O=C(O)C(=O)O.O=C1c2ccccc2C(=O)N1OCC#CCN1CCCC1 |
| InChI | InChI=1S/C16H16N2O3.C2H2O4/c19-15-13-7-1-2-8-14(13)16(20)18(15)21-12-6-5-11-17-9-3-4-10-17;3-1(4)2(5)6/h1-2,7-8H,3-4,9-12H2;(H,3,4)(H,5,6) |
| InChIKey | LCCXFTJUKBWLSG-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 124.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze oxalic acid;2-(4-pyrrolidin-1-ylbut-2-ynoxy)isoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxalic acid;2-(4-pyrrolidin-1-ylbut-2-ynoxy)isoindole-1,3-dione?
The IUPAC name of oxalic acid;2-(4-pyrrolidin-1-ylbut-2-ynoxy)isoindole-1,3-dione (CID 21153520) is oxalic acid;2-(4-pyrrolidin-1-ylbut-2-ynoxy)isoindole-1,3-dione.
What is the SMILES notation for oxalic acid;2-(4-pyrrolidin-1-ylbut-2-ynoxy)isoindole-1,3-dione?
The canonical SMILES for oxalic acid;2-(4-pyrrolidin-1-ylbut-2-ynoxy)isoindole-1,3-dione is O=C(O)C(=O)O.O=C1c2ccccc2C(=O)N1OCC#CCN1CCCC1.
What is the InChIKey of oxalic acid;2-(4-pyrrolidin-1-ylbut-2-ynoxy)isoindole-1,3-dione?
The InChIKey is LCCXFTJUKBWLSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O3.C2H2O4/c19-15-13-7-1-2-8-14(13)16(20)18(15)21-12-6-5-11-17-9-3-4-10-17;3-1(4)2(5)6/h1-2,7-8H,3-4,9-12H2;(H,3,4)(H,5,6).
What are the key properties of oxalic acid;2-(4-pyrrolidin-1-ylbut-2-ynoxy)isoindole-1,3-dione?
oxalic acid;2-(4-pyrrolidin-1-ylbut-2-ynoxy)isoindole-1,3-dione has a molecular weight of 374.35 g/mol, XLogP of 0.47, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for oxalic acid;2-(4-pyrrolidin-1-ylbut-2-ynoxy)isoindole-1,3-dione is sourced from PubChem (CID 21153520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).