C15H17FN4O — CID 64545703
1-(4-fluorophenyl)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]cyclopropane-1-carboxamide (PubChem CID 64545703) has the molecular formula C15H17FN4O and a molecular weight of 288.33 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]cyclopropane-1-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 64545703 |
| Molecular Formula | C15H17FN4O |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 1-(4-fluorophenyl)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]cyclopropane-1-carboxamide |
| SMILES | O=C(NCCCc1ncn[nH]1)C1(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C15H17FN4O/c16-12-5-3-11(4-6-12)15(7-8-15)14(21)17-9-1-2-13-18-10-19-20-13/h3-6,10H,1-2,7-9H2,(H,17,21)(H,18,19,20) |
| InChIKey | PAUQHVNJBBKTTC-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|