C15H21N3O18 — CID 6454595
4-[(3S,4S,5R,6S)-5,6-bis(2-carboxy-1-nitroethyl)-3,4,5,6-tetrahydroxyoxan-2-yl]-4-hydroxy-3-nitrobutanoic acid (PubChem CID 6454595) has the molecular formula C15H21N3O18 and a molecular weight of 531.34 g/mol. Its IUPAC name is 4-[(3S,4S,5R,6S)-5,6-bis(2-carboxy-1-nitroethyl)-3,4,5,6-tetrahydroxyoxan-2-yl]-4-hydroxy-3-nitrobutanoic acid.
| Compound Name | 4-[(3S,4S,5R,6S)-5,6-bis(2-carboxy-1-nitroethyl)-3,4,5,6-tetrahydroxyoxan-2-yl]-4-hydroxy-3-nitrobutanoic acid |
|---|---|
| PubChem CID | 6454595 |
| Molecular Formula | C15H21N3O18 |
| Molecular Weight | 531.34 g/mol |
| Exact Mass | 531.08 |
| IUPAC Name | 4-[(3S,4S,5R,6S)-5,6-bis(2-carboxy-1-nitroethyl)-3,4,5,6-tetrahydroxyoxan-2-yl]-4-hydroxy-3-nitrobutanoic acid |
| SMILES | O=C(O)CC(C(O)C1O[C@@](O)(C(CC(=O)O)[N+](=O)[O-])[C@@](O)(C(CC(=O)O)[N+](=O)[O-])[C@@H](O)[C@@H]1O)[N+](=O)[O-] |
| InChI | InChI=1S/C15H21N3O18/c19-7(20)1-4(16(30)31)10(25)12-11(26)13(27)14(28,5(17(32)33)2-8(21)22)15(29,36-12)6(18(34)35)3-9(23)24/h4-6,10-13,25-29H,1-3H2,(H,19,20)(H,21,22)(H,23,24)/t4?,5?,6?,10?,11-,12?,13+,14-,15+/m1/s1 |
| InChIKey | PYWXNZCLLZXVGG-MNWYQOIMSA-N |
| XLogP | -4.75 |
| TPSA | 351.70 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.34 |
| LogP ≤ 5 | -4.75 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|