C10H17NO9 — CID 54596666
3-(nitromethyl)-4-[(3R,4S,5S,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]butanoic acid (PubChem CID 54596666) has the molecular formula C10H17NO9 and a molecular weight of 295.24 g/mol. Its IUPAC name is 3-(nitromethyl)-4-[(3R,4S,5S,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]butanoic acid.
| Compound Name | 3-(nitromethyl)-4-[(3R,4S,5S,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]butanoic acid |
|---|---|
| PubChem CID | 54596666 |
| Molecular Formula | C10H17NO9 |
| Molecular Weight | 295.24 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 3-(nitromethyl)-4-[(3R,4S,5S,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]butanoic acid |
| SMILES | O=C(O)CC(CC1O[C@H](O)[C@@H](O)[C@@H](O)[C@H]1O)C[N+](=O)[O-] |
| InChI | InChI=1S/C10H17NO9/c12-6(13)2-4(3-11(18)19)1-5-7(14)8(15)9(16)10(17)20-5/h4-5,7-10,14-17H,1-3H2,(H,12,13)/t4?,5?,7-,8-,9-,10-/m0/s1 |
| InChIKey | JHIPLTDWFSIFHU-LDSKRPQSSA-N |
| XLogP | -2.46 |
| TPSA | 170.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.24 |
| LogP ≤ 5 | -2.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|