C13H21NO10 — CID 11854164
2-[4-oxo-4-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methylamino]butyl]propanedioic acid (PubChem CID 11854164) has the molecular formula C13H21NO10 and a molecular weight of 351.31 g/mol. Its IUPAC name is 2-[4-oxo-4-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methylamino]butyl]propanedioic acid.
| Compound Name | 2-[4-oxo-4-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methylamino]butyl]propanedioic acid |
|---|---|
| PubChem CID | 11854164 |
| Molecular Formula | C13H21NO10 |
| Molecular Weight | 351.31 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 2-[4-oxo-4-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methylamino]butyl]propanedioic acid |
| SMILES | O=C(CCCC(C(=O)O)C(=O)O)NC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H21NO10/c15-7(3-1-2-5(11(19)20)12(21)22)14-4-6-8(16)9(17)10(18)13(23)24-6/h5-6,8-10,13,16-18,23H,1-4H2,(H,14,15)(H,19,20)(H,21,22)/t6-,8-,9+,10-,13?/m1/s1 |
| InChIKey | HTRMABWZDVZCHA-SKDQVZBRSA-N |
| XLogP | -3.14 |
| TPSA | 193.85 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.31 |
| LogP ≤ 5 | -3.14 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|