C13H25N3O10Pt — CID 11854160
azane;2-[4-oxo-4-[[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methylamino]butyl]propanedioate;platinum(2+) (PubChem CID 11854160) has the molecular formula C13H25N3O10Pt and a molecular weight of 578.43 g/mol. Its IUPAC name is azane;2-[4-oxo-4-[[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methylamino]butyl]propanedioate;platinum(2+).
| Compound Name | azane;2-[4-oxo-4-[[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methylamino]butyl]propanedioate;platinum(2+) |
|---|---|
| PubChem CID | 11854160 |
| Molecular Formula | C13H25N3O10Pt |
| Molecular Weight | 578.43 g/mol |
| Exact Mass | 578.12 |
| IUPAC Name | azane;2-[4-oxo-4-[[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methylamino]butyl]propanedioate;platinum(2+) |
| SMILES | N.N.O=C(CCCC(C(=O)[O-])C(=O)[O-])NC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@H]1O.[Pt+2] |
| InChI | InChI=1S/C13H21NO10.2H3N.Pt/c15-7(3-1-2-5(11(19)20)12(21)22)14-4-6-8(16)9(17)10(18)13(23)24-6;;;/h5-6,8-10,13,16-18,23H,1-4H2,(H,14,15)(H,19,20)(H,21,22);2*1H3;/q;;;+2/p-2/t6-,8+,9+,10-,13?;;;/m1.../s1 |
| InChIKey | UUKIHFFRWUFARO-AKOLHXBHSA-L |
| XLogP | -5.49 |
| TPSA | 269.51 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.43 |
| LogP ≤ 5 | -5.49 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|