C6H11O8P-2 — CID 101185586
trioxido-[[(2S,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl]phosphanium (PubChem CID 101185586) has the molecular formula C6H11O8P-2 and a molecular weight of 242.12 g/mol. Its IUPAC name is trioxido-[[(2S,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl]phosphanium.
| Compound Name | trioxido-[[(2S,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl]phosphanium |
|---|---|
| PubChem CID | 101185586 |
| Molecular Formula | C6H11O8P-2 |
| Molecular Weight | 242.12 g/mol |
| Exact Mass | 242.02 |
| IUPAC Name | trioxido-[[(2S,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl]phosphanium |
| SMILES | [O-][P+]([O-])([O-])C[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H13O8P/c7-3-2(1-15(11,12)13)14-6(10)5(9)4(3)8/h2-10H,1H2,(H2,11,12,13)/p-2/t2-,3-,4+,5-,6?/m1/s1 |
| InChIKey | DZTQILMTTKDVHK-GASJEMHNSA-L |
| XLogP | -5.37 |
| TPSA | 159.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.12 |
| LogP ≤ 5 | -5.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|