C10H13NO8 — CID 155811588
3-hydroxy-4-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methylamino]cyclobut-3-ene-1,2-dione (PubChem CID 155811588) has the molecular formula C10H13NO8 and a molecular weight of 275.21 g/mol. Its IUPAC name is 3-hydroxy-4-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methylamino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-hydroxy-4-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methylamino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 155811588 |
| Molecular Formula | C10H13NO8 |
| Molecular Weight | 275.21 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 3-hydroxy-4-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methylamino]cyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(O)c(NC[C@H]2OC(O)[C@H](O)[C@@H](O)[C@@H]2O)c1=O |
| InChI | InChI=1S/C10H13NO8/c12-4-2(19-10(18)9(17)7(4)15)1-11-3-5(13)8(16)6(3)14/h2,4,7,9-13,15,17-18H,1H2/t2-,4-,7+,9-,10?/m1/s1 |
| InChIKey | OMLVLKPCKBEGTR-ZKHCKPQJSA-N |
| XLogP | -3.80 |
| TPSA | 156.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.21 |
| LogP ≤ 5 | -3.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|