C12H17N3O2S2 — CID 64549640
3-[(4-ethyl-4-methyl-5H-1,3-thiazol-2-yl)amino]benzenesulfonamide (PubChem CID 64549640) has the molecular formula C12H17N3O2S2 and a molecular weight of 299.42 g/mol. Its IUPAC name is 3-[(4-ethyl-4-methyl-5H-1,3-thiazol-2-yl)amino]benzenesulfonamide.
| Compound Name | 3-[(4-ethyl-4-methyl-5H-1,3-thiazol-2-yl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 64549640 |
| Molecular Formula | C12H17N3O2S2 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 3-[(4-ethyl-4-methyl-5H-1,3-thiazol-2-yl)amino]benzenesulfonamide |
| SMILES | CCC1(C)CSC(Nc2cccc(S(N)(=O)=O)c2)=N1 |
| InChI | InChI=1S/C12H17N3O2S2/c1-3-12(2)8-18-11(15-12)14-9-5-4-6-10(7-9)19(13,16)17/h4-7H,3,8H2,1-2H3,(H,14,15)(H2,13,16,17) |
| InChIKey | SSBJLKBSKMGZIR-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |