About 3-[(5,5-dimethylthian-3-yl)amino]benzenesulfonamide
3-[(5,5-dimethylthian-3-yl)amino]benzenesulfonamide (PubChem CID 79955506) has the molecular formula C13H20N2O2S2
and a molecular weight of 300.45 g/mol. Its IUPAC name is 3-[(5,5-dimethylthian-3-yl)amino]benzenesulfonamide.
Molecular Properties
| Compound Name | 3-[(5,5-dimethylthian-3-yl)amino]benzenesulfonamide |
| PubChem CID | 79955506 |
| Molecular Formula | C13H20N2O2S2 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 3-[(5,5-dimethylthian-3-yl)amino]benzenesulfonamide |
| SMILES | CC1(C)CSCC(Nc2cccc(S(N)(=O)=O)c2)C1 |
| InChI | InChI=1S/C13H20N2O2S2/c1-13(2)7-11(8-18-9-13)15-10-4-3-5-12(6-10)19(14,16)17/h3-6,11,15H,7-9H2,1-2H3,(H2,14,16,17) |
| InChIKey | PFJSXEHNMGZZHN-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(5,5-dimethylthian-3-yl)amino]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5,5-dimethylthian-3-yl)amino]benzenesulfonamide?
The IUPAC name of 3-[(5,5-dimethylthian-3-yl)amino]benzenesulfonamide (CID 79955506) is 3-[(5,5-dimethylthian-3-yl)amino]benzenesulfonamide.
What is the SMILES notation for 3-[(5,5-dimethylthian-3-yl)amino]benzenesulfonamide?
The canonical SMILES for 3-[(5,5-dimethylthian-3-yl)amino]benzenesulfonamide is CC1(C)CSCC(Nc2cccc(S(N)(=O)=O)c2)C1.
What is the InChIKey of 3-[(5,5-dimethylthian-3-yl)amino]benzenesulfonamide?
The InChIKey is PFJSXEHNMGZZHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O2S2/c1-13(2)7-11(8-18-9-13)15-10-4-3-5-12(6-10)19(14,16)17/h3-6,11,15H,7-9H2,1-2H3,(H2,14,16,17).
What are the key properties of 3-[(5,5-dimethylthian-3-yl)amino]benzenesulfonamide?
3-[(5,5-dimethylthian-3-yl)amino]benzenesulfonamide has a molecular weight of 300.45 g/mol, XLogP of 2.28, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5,5-dimethylthian-3-yl)amino]benzenesulfonamide is sourced from PubChem (CID 79955506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).