C21H30O4 — CID 6455673
3-tert-butylbenzene-1,2-diol;4-tert-butylphenol;formaldehyde (PubChem CID 6455673) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is 3-tert-butylbenzene-1,2-diol;4-tert-butylphenol;formaldehyde.
| Compound Name | 3-tert-butylbenzene-1,2-diol;4-tert-butylphenol;formaldehyde |
|---|---|
| PubChem CID | 6455673 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | 3-tert-butylbenzene-1,2-diol;4-tert-butylphenol;formaldehyde |
| SMILES | C=O.CC(C)(C)c1ccc(O)cc1.CC(C)(C)c1cccc(O)c1O |
| InChI | InChI=1S/C10H14O2.C10H14O.CH2O/c1-10(2,3)7-5-4-6-8(11)9(7)12;1-10(2,3)8-4-6-9(11)7-5-8;1-2/h4-6,11-12H,1-3H3;4-7,11H,1-3H3;1H2 |
| InChIKey | FLUAWDBWXCDOOF-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|