C43H83N3O4 — CID 6455812
N'-(3-aminopropyl)-N'-methylpropane-1,3-diamine;bis((9Z,12Z)-octadeca-9,12-dienoic acid) (PubChem CID 6455812) has the molecular formula C43H83N3O4 and a molecular weight of 706.15 g/mol. Its IUPAC name is N'-(3-aminopropyl)-N'-methylpropane-1,3-diamine;bis((9Z,12Z)-octadeca-9,12-dienoic acid).
| Compound Name | N'-(3-aminopropyl)-N'-methylpropane-1,3-diamine;bis((9Z,12Z)-octadeca-9,12-dienoic acid) |
|---|---|
| PubChem CID | 6455812 |
| Molecular Formula | C43H83N3O4 |
| Molecular Weight | 706.15 g/mol |
| Exact Mass | 705.64 |
| IUPAC Name | N'-(3-aminopropyl)-N'-methylpropane-1,3-diamine;bis((9Z,12Z)-octadeca-9,12-dienoic acid) |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)O.CCCCC/C=C\C/C=C\CCCCCCCC(=O)O.CN(CCCN)CCCN |
| InChI | InChI=1S/2C18H32O2.C7H19N3/c2*1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-10(6-2-4-8)7-3-5-9/h2*6-7,9-10H,2-5,8,11-17H2,1H3,(H,19,20);2-9H2,1H3/b2*7-6-,10-9-; |
| InChIKey | AUEKAWGDLDEOFZ-GRVYQHKQSA-N |
| XLogP | 11.38 |
| TPSA | 129.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.15 |
| LogP ≤ 5 | 11.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|