C11H20N2 — CID 64570071
2,3-dimethyl-N-(1H-pyrrol-2-ylmethyl)butan-1-amine (PubChem CID 64570071) has the molecular formula C11H20N2 and a molecular weight of 180.30 g/mol. Its IUPAC name is 2,3-dimethyl-N-(1H-pyrrol-2-ylmethyl)butan-1-amine.
| Compound Name | 2,3-dimethyl-N-(1H-pyrrol-2-ylmethyl)butan-1-amine |
|---|---|
| PubChem CID | 64570071 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.30 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 2,3-dimethyl-N-(1H-pyrrol-2-ylmethyl)butan-1-amine |
| SMILES | CC(C)C(C)CNCc1ccc[nH]1 |
| InChI | InChI=1S/C11H20N2/c1-9(2)10(3)7-12-8-11-5-4-6-13-11/h4-6,9-10,12-13H,7-8H2,1-3H3 |
| InChIKey | ZMRYNCWNULFBBS-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |