C8H14N2O2 — CID 66177182
3-(1H-pyrrol-2-ylmethylamino)propane-1,2-diol (PubChem CID 66177182) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is 3-(1H-pyrrol-2-ylmethylamino)propane-1,2-diol.
| Compound Name | 3-(1H-pyrrol-2-ylmethylamino)propane-1,2-diol |
|---|---|
| PubChem CID | 66177182 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 3-(1H-pyrrol-2-ylmethylamino)propane-1,2-diol |
| SMILES | OCC(O)CNCc1ccc[nH]1 |
| InChI | InChI=1S/C8H14N2O2/c11-6-8(12)5-9-4-7-2-1-3-10-7/h1-3,8-12H,4-6H2 |
| InChIKey | POVLPJIKCYICQL-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 68.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |