C12H22N2 — CID 83142379
2,3,3-trimethyl-N-(1H-pyrrol-2-ylmethyl)butan-1-amine (PubChem CID 83142379) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is 2,3,3-trimethyl-N-(1H-pyrrol-2-ylmethyl)butan-1-amine.
| Compound Name | 2,3,3-trimethyl-N-(1H-pyrrol-2-ylmethyl)butan-1-amine |
|---|---|
| PubChem CID | 83142379 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 2,3,3-trimethyl-N-(1H-pyrrol-2-ylmethyl)butan-1-amine |
| SMILES | CC(CNCc1ccc[nH]1)C(C)(C)C |
| InChI | InChI=1S/C12H22N2/c1-10(12(2,3)4)8-13-9-11-6-5-7-14-11/h5-7,10,13-14H,8-9H2,1-4H3 |
| InChIKey | IDHBSYJUDFJQGA-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |