C10H19N3 — CID 115138127
3-methyl-2-N-(1H-pyrrol-2-ylmethyl)butane-1,2-diamine (PubChem CID 115138127) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is 3-methyl-2-N-(1H-pyrrol-2-ylmethyl)butane-1,2-diamine.
| Compound Name | 3-methyl-2-N-(1H-pyrrol-2-ylmethyl)butane-1,2-diamine |
|---|---|
| PubChem CID | 115138127 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | 3-methyl-2-N-(1H-pyrrol-2-ylmethyl)butane-1,2-diamine |
| SMILES | CC(C)C(CN)NCc1ccc[nH]1 |
| InChI | InChI=1S/C10H19N3/c1-8(2)10(6-11)13-7-9-4-3-5-12-9/h3-5,8,10,12-13H,6-7,11H2,1-2H3 |
| InChIKey | ASQMZWNOOIHAQU-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |