C9H13F3N2 — CID 103578817
4,4,4-trifluoro-N-(1H-pyrrol-2-ylmethyl)butan-2-amine (PubChem CID 103578817) has the molecular formula C9H13F3N2 and a molecular weight of 206.21 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-(1H-pyrrol-2-ylmethyl)butan-2-amine.
| Compound Name | 4,4,4-trifluoro-N-(1H-pyrrol-2-ylmethyl)butan-2-amine |
|---|---|
| PubChem CID | 103578817 |
| Molecular Formula | C9H13F3N2 |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.10 |
| IUPAC Name | 4,4,4-trifluoro-N-(1H-pyrrol-2-ylmethyl)butan-2-amine |
| SMILES | CC(CC(F)(F)F)NCc1ccc[nH]1 |
| InChI | InChI=1S/C9H13F3N2/c1-7(5-9(10,11)12)14-6-8-3-2-4-13-8/h2-4,7,13-14H,5-6H2,1H3 |
| InChIKey | STKNICVPEZFIHG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |