C12H27NO2S2 — CID 64611891
3,3-dimethyl-1-(2-methylsulfonylethylsulfanyl)-N-propylbutan-2-amine (PubChem CID 64611891) has the molecular formula C12H27NO2S2 and a molecular weight of 281.49 g/mol. Its IUPAC name is 3,3-dimethyl-1-(2-methylsulfonylethylsulfanyl)-N-propylbutan-2-amine.
| Compound Name | 3,3-dimethyl-1-(2-methylsulfonylethylsulfanyl)-N-propylbutan-2-amine |
|---|---|
| PubChem CID | 64611891 |
| Molecular Formula | C12H27NO2S2 |
| Molecular Weight | 281.49 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 3,3-dimethyl-1-(2-methylsulfonylethylsulfanyl)-N-propylbutan-2-amine |
| SMILES | CCCNC(CSCCS(C)(=O)=O)C(C)(C)C |
| InChI | InChI=1S/C12H27NO2S2/c1-6-7-13-11(12(2,3)4)10-16-8-9-17(5,14)15/h11,13H,6-10H2,1-5H3 |
| InChIKey | OINUEHKEESOYJI-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.49 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|