C9H15NO6S2 — CID 64618014
2-[1-(1,1-dioxothiolan-3-yl)sulfonylazetidin-3-yl]acetic acid (PubChem CID 64618014) has the molecular formula C9H15NO6S2 and a molecular weight of 297.35 g/mol. Its IUPAC name is 2-[1-(1,1-dioxothiolan-3-yl)sulfonylazetidin-3-yl]acetic acid.
| Compound Name | 2-[1-(1,1-dioxothiolan-3-yl)sulfonylazetidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 64618014 |
| Molecular Formula | C9H15NO6S2 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | 2-[1-(1,1-dioxothiolan-3-yl)sulfonylazetidin-3-yl]acetic acid |
| SMILES | O=C(O)CC1CN(S(=O)(=O)C2CCS(=O)(=O)C2)C1 |
| InChI | InChI=1S/C9H15NO6S2/c11-9(12)3-7-4-10(5-7)18(15,16)8-1-2-17(13,14)6-8/h7-8H,1-6H2,(H,11,12) |
| InChIKey | BCTBCZNFLRNGLJ-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 108.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |