About 4-(2-methyl-1,4-oxazepan-4-yl)cinnoline-3-carboxylic acid
4-(2-methyl-1,4-oxazepan-4-yl)cinnoline-3-carboxylic acid (PubChem CID 64622507) has the molecular formula C15H17N3O3
and a molecular weight of 287.32 g/mol. Its IUPAC name is 4-(2-methyl-1,4-oxazepan-4-yl)cinnoline-3-carboxylic acid.
Molecular Properties
| Compound Name | 4-(2-methyl-1,4-oxazepan-4-yl)cinnoline-3-carboxylic acid |
| PubChem CID | 64622507 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 4-(2-methyl-1,4-oxazepan-4-yl)cinnoline-3-carboxylic acid |
| SMILES | CC1CN(c2c(C(=O)O)nnc3ccccc23)CCCO1 |
| InChI | InChI=1S/C15H17N3O3/c1-10-9-18(7-4-8-21-10)14-11-5-2-3-6-12(11)16-17-13(14)15(19)20/h2-3,5-6,10H,4,7-9H2,1H3,(H,19,20) |
| InChIKey | IEKMKFCZWWQEMF-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(2-methyl-1,4-oxazepan-4-yl)cinnoline-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methyl-1,4-oxazepan-4-yl)cinnoline-3-carboxylic acid?
The IUPAC name of 4-(2-methyl-1,4-oxazepan-4-yl)cinnoline-3-carboxylic acid (CID 64622507) is 4-(2-methyl-1,4-oxazepan-4-yl)cinnoline-3-carboxylic acid.
What is the SMILES notation for 4-(2-methyl-1,4-oxazepan-4-yl)cinnoline-3-carboxylic acid?
The canonical SMILES for 4-(2-methyl-1,4-oxazepan-4-yl)cinnoline-3-carboxylic acid is CC1CN(c2c(C(=O)O)nnc3ccccc23)CCCO1.
What is the InChIKey of 4-(2-methyl-1,4-oxazepan-4-yl)cinnoline-3-carboxylic acid?
The InChIKey is IEKMKFCZWWQEMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3O3/c1-10-9-18(7-4-8-21-10)14-11-5-2-3-6-12(11)16-17-13(14)15(19)20/h2-3,5-6,10H,4,7-9H2,1H3,(H,19,20).
What are the key properties of 4-(2-methyl-1,4-oxazepan-4-yl)cinnoline-3-carboxylic acid?
4-(2-methyl-1,4-oxazepan-4-yl)cinnoline-3-carboxylic acid has a molecular weight of 287.32 g/mol, XLogP of 1.94, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methyl-1,4-oxazepan-4-yl)cinnoline-3-carboxylic acid is sourced from PubChem (CID 64622507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).