About 4-[2-(difluoromethyl)quinazolin-4-yl]-2-methyl-1,4-oxazepane
4-[2-(difluoromethyl)quinazolin-4-yl]-2-methyl-1,4-oxazepane (PubChem CID 154836416) has the molecular formula C15H17F2N3O
and a molecular weight of 293.32 g/mol. Its IUPAC name is 4-[2-(difluoromethyl)quinazolin-4-yl]-2-methyl-1,4-oxazepane.
Molecular Properties
| Compound Name | 4-[2-(difluoromethyl)quinazolin-4-yl]-2-methyl-1,4-oxazepane |
| PubChem CID | 154836416 |
| Molecular Formula | C15H17F2N3O |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 4-[2-(difluoromethyl)quinazolin-4-yl]-2-methyl-1,4-oxazepane |
| SMILES | CC1CN(c2nc(C(F)F)nc3ccccc23)CCCO1 |
| InChI | InChI=1S/C15H17F2N3O/c1-10-9-20(7-4-8-21-10)15-11-5-2-3-6-12(11)18-14(19-15)13(16)17/h2-3,5-6,10,13H,4,7-9H2,1H3 |
| InChIKey | BGJNFEQOPJGKRH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[2-(difluoromethyl)quinazolin-4-yl]-2-methyl-1,4-oxazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(difluoromethyl)quinazolin-4-yl]-2-methyl-1,4-oxazepane?
The IUPAC name of 4-[2-(difluoromethyl)quinazolin-4-yl]-2-methyl-1,4-oxazepane (CID 154836416) is 4-[2-(difluoromethyl)quinazolin-4-yl]-2-methyl-1,4-oxazepane.
What is the SMILES notation for 4-[2-(difluoromethyl)quinazolin-4-yl]-2-methyl-1,4-oxazepane?
The canonical SMILES for 4-[2-(difluoromethyl)quinazolin-4-yl]-2-methyl-1,4-oxazepane is CC1CN(c2nc(C(F)F)nc3ccccc23)CCCO1.
What is the InChIKey of 4-[2-(difluoromethyl)quinazolin-4-yl]-2-methyl-1,4-oxazepane?
The InChIKey is BGJNFEQOPJGKRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17F2N3O/c1-10-9-20(7-4-8-21-10)15-11-5-2-3-6-12(11)18-14(19-15)13(16)17/h2-3,5-6,10,13H,4,7-9H2,1H3.
What are the key properties of 4-[2-(difluoromethyl)quinazolin-4-yl]-2-methyl-1,4-oxazepane?
4-[2-(difluoromethyl)quinazolin-4-yl]-2-methyl-1,4-oxazepane has a molecular weight of 293.32 g/mol, XLogP of 3.18, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(difluoromethyl)quinazolin-4-yl]-2-methyl-1,4-oxazepane is sourced from PubChem (CID 154836416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).