C15H17F2N3O — CID 154836416
4-[2-(difluoromethyl)quinazolin-4-yl]-2-methyl-1,4-oxazepane (PubChem CID 154836416) has the molecular formula C15H17F2N3O and a molecular weight of 293.32 g/mol. Its IUPAC name is 4-[2-(difluoromethyl)quinazolin-4-yl]-2-methyl-1,4-oxazepane.
| Compound Name | 4-[2-(difluoromethyl)quinazolin-4-yl]-2-methyl-1,4-oxazepane |
|---|---|
| PubChem CID | 154836416 |
| Molecular Formula | C15H17F2N3O |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 4-[2-(difluoromethyl)quinazolin-4-yl]-2-methyl-1,4-oxazepane |
| SMILES | CC1CN(c2nc(C(F)F)nc3ccccc23)CCCO1 |
| InChI | InChI=1S/C15H17F2N3O/c1-10-9-20(7-4-8-21-10)15-11-5-2-3-6-12(11)18-14(19-15)13(16)17/h2-3,5-6,10,13H,4,7-9H2,1H3 |
| InChIKey | BGJNFEQOPJGKRH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |