C16H24N2O2S — CID 64623774
3-[[(3-cyclopropylcyclohexyl)amino]methyl]benzenesulfonamide (PubChem CID 64623774) has the molecular formula C16H24N2O2S and a molecular weight of 308.45 g/mol. Its IUPAC name is 3-[[(3-cyclopropylcyclohexyl)amino]methyl]benzenesulfonamide.
| Compound Name | 3-[[(3-cyclopropylcyclohexyl)amino]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 64623774 |
| Molecular Formula | C16H24N2O2S |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 3-[[(3-cyclopropylcyclohexyl)amino]methyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cccc(CNC2CCCC(C3CC3)C2)c1 |
| InChI | InChI=1S/C16H24N2O2S/c17-21(19,20)16-6-1-3-12(9-16)11-18-15-5-2-4-14(10-15)13-7-8-13/h1,3,6,9,13-15,18H,2,4-5,7-8,10-11H2,(H2,17,19,20) |
| InChIKey | WJTCWPJYGVOYEE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |