C14H18N2OS2 — CID 64626305
1-[4-ethoxy-3-(1,3-thiazol-2-ylsulfanylmethyl)phenyl]ethanamine (PubChem CID 64626305) has the molecular formula C14H18N2OS2 and a molecular weight of 294.44 g/mol. Its IUPAC name is 1-[4-ethoxy-3-(1,3-thiazol-2-ylsulfanylmethyl)phenyl]ethanamine.
| Compound Name | 1-[4-ethoxy-3-(1,3-thiazol-2-ylsulfanylmethyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 64626305 |
| Molecular Formula | C14H18N2OS2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 1-[4-ethoxy-3-(1,3-thiazol-2-ylsulfanylmethyl)phenyl]ethanamine |
| SMILES | CCOc1ccc(C(C)N)cc1CSc1nccs1 |
| InChI | InChI=1S/C14H18N2OS2/c1-3-17-13-5-4-11(10(2)15)8-12(13)9-19-14-16-6-7-18-14/h4-8,10H,3,9,15H2,1-2H3 |
| InChIKey | GEHNNXNQFRHXGF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|