C14H14F3N3S — CID 64626652
N-methyl-2-pyrimidin-4-ylsulfanyl-1-[3-(trifluoromethyl)phenyl]ethanamine (PubChem CID 64626652) has the molecular formula C14H14F3N3S and a molecular weight of 313.35 g/mol. Its IUPAC name is N-methyl-2-pyrimidin-4-ylsulfanyl-1-[3-(trifluoromethyl)phenyl]ethanamine.
| Compound Name | N-methyl-2-pyrimidin-4-ylsulfanyl-1-[3-(trifluoromethyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 64626652 |
| Molecular Formula | C14H14F3N3S |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | N-methyl-2-pyrimidin-4-ylsulfanyl-1-[3-(trifluoromethyl)phenyl]ethanamine |
| SMILES | CNC(CSc1ccncn1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H14F3N3S/c1-18-12(8-21-13-5-6-19-9-20-13)10-3-2-4-11(7-10)14(15,16)17/h2-7,9,12,18H,8H2,1H3 |
| InChIKey | SDUMUGSUDPSMSI-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |