C12H13Cl2N3O2 — CID 646337
3-[(2,5-dichloroanilino)methyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 646337) has the molecular formula C12H13Cl2N3O2 and a molecular weight of 302.16 g/mol. Its IUPAC name is 3-[(2,5-dichloroanilino)methyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[(2,5-dichloroanilino)methyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 646337 |
| Molecular Formula | C12H13Cl2N3O2 |
| Molecular Weight | 302.16 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | 3-[(2,5-dichloroanilino)methyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CC1(C)NC(=O)N(CNc2cc(Cl)ccc2Cl)C1=O |
| InChI | InChI=1S/C12H13Cl2N3O2/c1-12(2)10(18)17(11(19)16-12)6-15-9-5-7(13)3-4-8(9)14/h3-5,15H,6H2,1-2H3,(H,16,19) |
| InChIKey | KAVUUOXITZCINW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.16 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|