C12H14N2O3S — CID 6463565
1-(5-methoxy-2,4-dimethylphenyl)sulfonylpyrazole (PubChem CID 6463565) has the molecular formula C12H14N2O3S and a molecular weight of 266.32 g/mol. Its IUPAC name is 1-(5-methoxy-2,4-dimethylphenyl)sulfonylpyrazole.
| Compound Name | 1-(5-methoxy-2,4-dimethylphenyl)sulfonylpyrazole |
|---|---|
| PubChem CID | 6463565 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 1-(5-methoxy-2,4-dimethylphenyl)sulfonylpyrazole |
| SMILES | COc1cc(S(=O)(=O)n2cccn2)c(C)cc1C |
| InChI | InChI=1S/C12H14N2O3S/c1-9-7-10(2)12(8-11(9)17-3)18(15,16)14-6-4-5-13-14/h4-8H,1-3H3 |
| InChIKey | GDTKAMNEZIHCKQ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |