C10H10FN3 — CID 64689905
6-(3-fluorophenyl)-4,5-dihydropyridazin-3-amine (PubChem CID 64689905) has the molecular formula C10H10FN3 and a molecular weight of 191.21 g/mol. Its IUPAC name is 6-(3-fluorophenyl)-4,5-dihydropyridazin-3-amine.
| Compound Name | 6-(3-fluorophenyl)-4,5-dihydropyridazin-3-amine |
|---|---|
| PubChem CID | 64689905 |
| Molecular Formula | C10H10FN3 |
| Molecular Weight | 191.21 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 6-(3-fluorophenyl)-4,5-dihydropyridazin-3-amine |
| SMILES | NC1=NN=C(c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C10H10FN3/c11-8-3-1-2-7(6-8)9-4-5-10(12)14-13-9/h1-3,6H,4-5H2,(H2,12,14) |
| InChIKey | IOIFZHAIKYTUSR-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.21 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |