C11H12FN3 — CID 64692601
6-(3-fluorophenyl)-4-methyl-4,5-dihydropyridazin-3-amine (PubChem CID 64692601) has the molecular formula C11H12FN3 and a molecular weight of 205.24 g/mol. Its IUPAC name is 6-(3-fluorophenyl)-4-methyl-4,5-dihydropyridazin-3-amine.
| Compound Name | 6-(3-fluorophenyl)-4-methyl-4,5-dihydropyridazin-3-amine |
|---|---|
| PubChem CID | 64692601 |
| Molecular Formula | C11H12FN3 |
| Molecular Weight | 205.24 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | 6-(3-fluorophenyl)-4-methyl-4,5-dihydropyridazin-3-amine |
| SMILES | CC1CC(c2cccc(F)c2)=NN=C1N |
| InChI | InChI=1S/C11H12FN3/c1-7-5-10(14-15-11(7)13)8-3-2-4-9(12)6-8/h2-4,6-7H,5H2,1H3,(H2,13,15) |
| InChIKey | FLMLTHSDONRGJK-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.24 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |