C13H13FN2O — CID 142421761
(1R,5R,6S)-3-(3-fluorophenyl)-N'-hydroxybicyclo[3.1.0]hex-2-ene-6-carboximidamide (PubChem CID 142421761) has the molecular formula C13H13FN2O and a molecular weight of 232.26 g/mol. Its IUPAC name is (1R,5R,6S)-3-(3-fluorophenyl)-N'-hydroxybicyclo[3.1.0]hex-2-ene-6-carboximidamide.
| Compound Name | (1R,5R,6S)-3-(3-fluorophenyl)-N'-hydroxybicyclo[3.1.0]hex-2-ene-6-carboximidamide |
|---|---|
| PubChem CID | 142421761 |
| Molecular Formula | C13H13FN2O |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | (1R,5R,6S)-3-(3-fluorophenyl)-N'-hydroxybicyclo[3.1.0]hex-2-ene-6-carboximidamide |
| SMILES | N/C(=N\O)[C@@H]1[C@H]2C=C(c3cccc(F)c3)C[C@H]21 |
| InChI | InChI=1S/C13H13FN2O/c14-9-3-1-2-7(4-9)8-5-10-11(6-8)12(10)13(15)16-17/h1-5,10-12,17H,6H2,(H2,15,16)/t10-,11+,12+/m0/s1 |
| InChIKey | OZSQABZUHWZPED-QJPTWQEYSA-N |
| XLogP | 2.22 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|