C10H17N3O — CID 64692389
4-methyl-6-(oxan-4-yl)-4,5-dihydropyridazin-3-amine (PubChem CID 64692389) has the molecular formula C10H17N3O and a molecular weight of 195.27 g/mol. Its IUPAC name is 4-methyl-6-(oxan-4-yl)-4,5-dihydropyridazin-3-amine.
| Compound Name | 4-methyl-6-(oxan-4-yl)-4,5-dihydropyridazin-3-amine |
|---|---|
| PubChem CID | 64692389 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 4-methyl-6-(oxan-4-yl)-4,5-dihydropyridazin-3-amine |
| SMILES | CC1CC(C2CCOCC2)=NN=C1N |
| InChI | InChI=1S/C10H17N3O/c1-7-6-9(12-13-10(7)11)8-2-4-14-5-3-8/h7-8H,2-6H2,1H3,(H2,11,13) |
| InChIKey | YIERGASWGBIHHK-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |