C17H25NO3 — CID 64733075
1-(1,3-benzodioxol-5-yl)-2-[(3,5-dimethylcyclohexyl)amino]ethanol (PubChem CID 64733075) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-2-[(3,5-dimethylcyclohexyl)amino]ethanol.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-2-[(3,5-dimethylcyclohexyl)amino]ethanol |
|---|---|
| PubChem CID | 64733075 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-2-[(3,5-dimethylcyclohexyl)amino]ethanol |
| SMILES | CC1CC(C)CC(NCC(O)c2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C17H25NO3/c1-11-5-12(2)7-14(6-11)18-9-15(19)13-3-4-16-17(8-13)21-10-20-16/h3-4,8,11-12,14-15,18-19H,5-7,9-10H2,1-2H3 |
| InChIKey | RKCTXWXGXDMFKK-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |