C17H27N3O — CID 64740693
4-amino-2-[(3,4-dimethylcyclohexyl)amino]-N-ethylbenzamide (PubChem CID 64740693) has the molecular formula C17H27N3O and a molecular weight of 289.42 g/mol. Its IUPAC name is 4-amino-2-[(3,4-dimethylcyclohexyl)amino]-N-ethylbenzamide.
| Compound Name | 4-amino-2-[(3,4-dimethylcyclohexyl)amino]-N-ethylbenzamide |
|---|---|
| PubChem CID | 64740693 |
| Molecular Formula | C17H27N3O |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | 4-amino-2-[(3,4-dimethylcyclohexyl)amino]-N-ethylbenzamide |
| SMILES | CCNC(=O)c1ccc(N)cc1NC1CCC(C)C(C)C1 |
| InChI | InChI=1S/C17H27N3O/c1-4-19-17(21)15-8-6-13(18)10-16(15)20-14-7-5-11(2)12(3)9-14/h6,8,10-12,14,20H,4-5,7,9,18H2,1-3H3,(H,19,21) |
| InChIKey | FYOCIZXJEKPHGX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|