C18H15N3O11 — CID 6476208
methyl 2-[4-[2-hydroxy-3-methoxy-5-[(E)-2-nitroethenyl]phenoxy]-3,5-dinitrophenyl]acetate (PubChem CID 6476208) has the molecular formula C18H15N3O11 and a molecular weight of 449.33 g/mol. Its IUPAC name is methyl 2-[4-[2-hydroxy-3-methoxy-5-[(E)-2-nitroethenyl]phenoxy]-3,5-dinitrophenyl]acetate.
| Compound Name | methyl 2-[4-[2-hydroxy-3-methoxy-5-[(E)-2-nitroethenyl]phenoxy]-3,5-dinitrophenyl]acetate |
|---|---|
| PubChem CID | 6476208 |
| Molecular Formula | C18H15N3O11 |
| Molecular Weight | 449.33 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | methyl 2-[4-[2-hydroxy-3-methoxy-5-[(E)-2-nitroethenyl]phenoxy]-3,5-dinitrophenyl]acetate |
| SMILES | COC(=O)Cc1cc([N+](=O)[O-])c(Oc2cc(/C=C/[N+](=O)[O-])cc(OC)c2O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H15N3O11/c1-30-14-7-10(3-4-19(24)25)8-15(17(14)23)32-18-12(20(26)27)5-11(9-16(22)31-2)6-13(18)21(28)29/h3-8,23H,9H2,1-2H3/b4-3+ |
| InChIKey | DDIPMEDKXKFUGM-ONEGZZNKSA-N |
| XLogP | 2.97 |
| TPSA | 194.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.33 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|