C18H26N2 — CID 6480553
N-(2-adamantyl)-N'-phenylethane-1,2-diamine (PubChem CID 6480553) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is N-(2-adamantyl)-N'-phenylethane-1,2-diamine.
| Compound Name | N-(2-adamantyl)-N'-phenylethane-1,2-diamine |
|---|---|
| PubChem CID | 6480553 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | N-(2-adamantyl)-N'-phenylethane-1,2-diamine |
| SMILES | c1ccc(NCCNC2C3CC4CC(C3)CC2C4)cc1 |
| InChI | InChI=1S/C18H26N2/c1-2-4-17(5-3-1)19-6-7-20-18-15-9-13-8-14(11-15)12-16(18)10-13/h1-5,13-16,18-20H,6-12H2 |
| InChIKey | YOYUPJIKXSORJK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|